C18H20F2N4O — CID 154703939
1-[4-[[3-fluoro-4-(2-fluoro-6-methylpyrimidin-4-yl)phenyl]methyl]piperazin-1-yl]ethanone (PubChem CID 154703939) has the molecular formula C18H20F2N4O and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-[4-[[3-fluoro-4-(2-fluoro-6-methylpyrimidin-4-yl)phenyl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[[3-fluoro-4-(2-fluoro-6-methylpyrimidin-4-yl)phenyl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 154703939 |
| Molecular Formula | C18H20F2N4O |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-[4-[[3-fluoro-4-(2-fluoro-6-methylpyrimidin-4-yl)phenyl]methyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(Cc2ccc(-c3cc(C)nc(F)n3)c(F)c2)CC1 |
| InChI | InChI=1S/C18H20F2N4O/c1-12-9-17(22-18(20)21-12)15-4-3-14(10-16(15)19)11-23-5-7-24(8-6-23)13(2)25/h3-4,9-10H,5-8,11H2,1-2H3 |
| InChIKey | IFKIIMYZRZLDEE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |