C12H17BrN2O5S — CID 154704455
(2S,3R)-2-acetamido-N-(3-bromoprop-2-ynyl)-3-(1,1-dioxothietan-3-yl)oxybutanamide (PubChem CID 154704455) has the molecular formula C12H17BrN2O5S and a molecular weight of 381.25 g/mol. Its IUPAC name is (2S,3R)-2-acetamido-N-(3-bromoprop-2-ynyl)-3-(1,1-dioxothietan-3-yl)oxybutanamide.
| Compound Name | (2S,3R)-2-acetamido-N-(3-bromoprop-2-ynyl)-3-(1,1-dioxothietan-3-yl)oxybutanamide |
|---|---|
| PubChem CID | 154704455 |
| Molecular Formula | C12H17BrN2O5S |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | (2S,3R)-2-acetamido-N-(3-bromoprop-2-ynyl)-3-(1,1-dioxothietan-3-yl)oxybutanamide |
| SMILES | CC(=O)N[C@H](C(=O)NCC#CBr)[C@@H](C)OC1CS(=O)(=O)C1 |
| InChI | InChI=1S/C12H17BrN2O5S/c1-8(20-10-6-21(18,19)7-10)11(15-9(2)16)12(17)14-5-3-4-13/h8,10-11H,5-7H2,1-2H3,(H,14,17)(H,15,16)/t8-,11+/m1/s1 |
| InChIKey | LNEIXIRZGJOMMJ-KCJUWKMLSA-N |
| XLogP | -0.83 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|