About 2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane
2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane (PubChem CID 15470458) has the molecular formula C13H15Br2ClO3
and a molecular weight of 414.52 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane |
| PubChem CID | 15470458 |
| Molecular Formula | C13H15Br2ClO3 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 411.91 |
| IUPAC Name | 2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane |
| SMILES | Clc1ccc(C2OCC(COCC(Br)CBr)O2)cc1 |
| InChI | InChI=1S/C13H15Br2ClO3/c14-5-10(15)6-17-7-12-8-18-13(19-12)9-1-3-11(16)4-2-9/h1-4,10,12-13H,5-8H2 |
| InChIKey | TXPXRHVGZVDQTP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane?
The IUPAC name of 2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane (CID 15470458) is 2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane.
What is the SMILES notation for 2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane?
The canonical SMILES for 2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane is Clc1ccc(C2OCC(COCC(Br)CBr)O2)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane?
The InChIKey is TXPXRHVGZVDQTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Br2ClO3/c14-5-10(15)6-17-7-12-8-18-13(19-12)9-1-3-11(16)4-2-9/h1-4,10,12-13H,5-8H2.
What are the key properties of 2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane?
2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane has a molecular weight of 414.52 g/mol, XLogP of 3.93, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-4-(2,3-dibromopropoxymethyl)-1,3-dioxolane is sourced from PubChem (CID 15470458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).