C11H6F4N2 — CID 15470461
2,3,5,6-tetrafluoro-N-phenylpyridin-4-amine (PubChem CID 15470461) has the molecular formula C11H6F4N2 and a molecular weight of 242.18 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-phenylpyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-phenylpyridin-4-amine |
|---|---|
| PubChem CID | 15470461 |
| Molecular Formula | C11H6F4N2 |
| Molecular Weight | 242.18 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-phenylpyridin-4-amine |
| SMILES | Fc1nc(F)c(F)c(Nc2ccccc2)c1F |
| InChI | InChI=1S/C11H6F4N2/c12-7-9(8(13)11(15)17-10(7)14)16-6-4-2-1-3-5-6/h1-5H,(H,16,17) |
| InChIKey | NSCVDHBQSVZYOX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.18 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|