About 2-butyl-4-methoxy-2,3-dihydropyran-6-one
2-butyl-4-methoxy-2,3-dihydropyran-6-one (PubChem CID 15470479) has the molecular formula C10H16O3
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-butyl-4-methoxy-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 2-butyl-4-methoxy-2,3-dihydropyran-6-one |
| PubChem CID | 15470479 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-butyl-4-methoxy-2,3-dihydropyran-6-one |
| SMILES | CCCCC1CC(OC)=CC(=O)O1 |
| InChI | InChI=1S/C10H16O3/c1-3-4-5-8-6-9(12-2)7-10(11)13-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | UGXSTAWDVRGMDJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butyl-4-methoxy-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4-methoxy-2,3-dihydropyran-6-one?
The IUPAC name of 2-butyl-4-methoxy-2,3-dihydropyran-6-one (CID 15470479) is 2-butyl-4-methoxy-2,3-dihydropyran-6-one.
What is the SMILES notation for 2-butyl-4-methoxy-2,3-dihydropyran-6-one?
The canonical SMILES for 2-butyl-4-methoxy-2,3-dihydropyran-6-one is CCCCC1CC(OC)=CC(=O)O1.
What is the InChIKey of 2-butyl-4-methoxy-2,3-dihydropyran-6-one?
The InChIKey is UGXSTAWDVRGMDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-3-4-5-8-6-9(12-2)7-10(11)13-8/h7-8H,3-6H2,1-2H3.
What are the key properties of 2-butyl-4-methoxy-2,3-dihydropyran-6-one?
2-butyl-4-methoxy-2,3-dihydropyran-6-one has a molecular weight of 184.24 g/mol, XLogP of 2.02, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4-methoxy-2,3-dihydropyran-6-one is sourced from PubChem (CID 15470479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).