C14H7F3N2O2 — CID 154705267
5-pyridin-4-yl-7-(trifluoromethyl)-1H-indole-2,3-dione (PubChem CID 154705267) has the molecular formula C14H7F3N2O2 and a molecular weight of 292.22 g/mol. Its IUPAC name is 5-pyridin-4-yl-7-(trifluoromethyl)-1H-indole-2,3-dione.
| Compound Name | 5-pyridin-4-yl-7-(trifluoromethyl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 154705267 |
| Molecular Formula | C14H7F3N2O2 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 5-pyridin-4-yl-7-(trifluoromethyl)-1H-indole-2,3-dione |
| SMILES | O=C1Nc2c(cc(-c3ccncc3)cc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C14H7F3N2O2/c15-14(16,17)10-6-8(7-1-3-18-4-2-7)5-9-11(10)19-13(21)12(9)20/h1-6H,(H,19,20,21) |
| InChIKey | FUGMFRDOVVCVNM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|