C19H18ClNO4 — CID 154706445
methyl (2R,6S)-6-[(3-chlorophenyl)methyl]-4-oxo-2-pyridin-3-yloxane-3-carboxylate (PubChem CID 154706445) has the molecular formula C19H18ClNO4 and a molecular weight of 359.81 g/mol. Its IUPAC name is methyl (2R,6S)-6-[(3-chlorophenyl)methyl]-4-oxo-2-pyridin-3-yloxane-3-carboxylate.
| Compound Name | methyl (2R,6S)-6-[(3-chlorophenyl)methyl]-4-oxo-2-pyridin-3-yloxane-3-carboxylate |
|---|---|
| PubChem CID | 154706445 |
| Molecular Formula | C19H18ClNO4 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | methyl (2R,6S)-6-[(3-chlorophenyl)methyl]-4-oxo-2-pyridin-3-yloxane-3-carboxylate |
| SMILES | COC(=O)C1C(=O)C[C@H](Cc2cccc(Cl)c2)O[C@H]1c1cccnc1 |
| InChI | InChI=1S/C19H18ClNO4/c1-24-19(23)17-16(22)10-15(9-12-4-2-6-14(20)8-12)25-18(17)13-5-3-7-21-11-13/h2-8,11,15,17-18H,9-10H2,1H3/t15-,17?,18-/m0/s1 |
| InChIKey | GOEPDBYXIACFMZ-YKOWGRMDSA-N |
| XLogP | 3.17 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|