C16H26N4O — CID 154706604
N,N-diethyl-2-[1-(pyridin-2-ylmethyl)piperazin-2-yl]acetamide (PubChem CID 154706604) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is N,N-diethyl-2-[1-(pyridin-2-ylmethyl)piperazin-2-yl]acetamide.
| Compound Name | N,N-diethyl-2-[1-(pyridin-2-ylmethyl)piperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 154706604 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | N,N-diethyl-2-[1-(pyridin-2-ylmethyl)piperazin-2-yl]acetamide |
| SMILES | CCN(CC)C(=O)CC1CNCCN1Cc1ccccn1 |
| InChI | InChI=1S/C16H26N4O/c1-3-19(4-2)16(21)11-15-12-17-9-10-20(15)13-14-7-5-6-8-18-14/h5-8,15,17H,3-4,9-13H2,1-2H3 |
| InChIKey | UXAORMBIWXXILO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |