About methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate
methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate (PubChem CID 15470689) has the molecular formula C18H12O6
and a molecular weight of 324.29 g/mol. Its IUPAC name is methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate.
Molecular Properties
| Compound Name | methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate |
| PubChem CID | 15470689 |
| Molecular Formula | C18H12O6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate |
| SMILES | COC(=O)C1=C(OC)C(=O)OC12C(=O)c1cccc3cccc2c13 |
| InChI | InChI=1S/C18H12O6/c1-22-14-13(16(20)23-2)18(24-17(14)21)11-8-4-6-9-5-3-7-10(12(9)11)15(18)19/h3-8H,1-2H3 |
| InChIKey | MZHLWBXBYWZRBU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate?
The IUPAC name of methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate (CID 15470689) is methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate.
What is the SMILES notation for methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate?
The canonical SMILES for methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate is COC(=O)C1=C(OC)C(=O)OC12C(=O)c1cccc3cccc2c13.
What is the InChIKey of methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate?
The InChIKey is MZHLWBXBYWZRBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O6/c1-22-14-13(16(20)23-2)18(24-17(14)21)11-8-4-6-9-5-3-7-10(12(9)11)15(18)19/h3-8H,1-2H3.
What are the key properties of methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate?
methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate has a molecular weight of 324.29 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4'-methoxy-2,5'-dioxospiro[acenaphthylene-1,2'-furan]-3'-carboxylate is sourced from PubChem (CID 15470689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).