C18H26N6O3 — CID 154706911
19-prop-2-ynoxy-3,6,9,12,15,21-hexazabicyclo[15.3.1]henicosa-1(20),17(21),18-triene-2,16-dione (PubChem CID 154706911) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is 19-prop-2-ynoxy-3,6,9,12,15,21-hexazabicyclo[15.3.1]henicosa-1(20),17(21),18-triene-2,16-dione.
| Compound Name | 19-prop-2-ynoxy-3,6,9,12,15,21-hexazabicyclo[15.3.1]henicosa-1(20),17(21),18-triene-2,16-dione |
|---|---|
| PubChem CID | 154706911 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 19-prop-2-ynoxy-3,6,9,12,15,21-hexazabicyclo[15.3.1]henicosa-1(20),17(21),18-triene-2,16-dione |
| SMILES | C#CCOc1cc2nc(c1)C(=O)NCCNCCNCCNCCNC2=O |
| InChI | InChI=1S/C18H26N6O3/c1-2-11-27-14-12-15-17(25)22-9-7-20-5-3-19-4-6-21-8-10-23-18(26)16(13-14)24-15/h1,12-13,19-21H,3-11H2,(H,22,25)(H,23,26) |
| InChIKey | MCZUWUDMNPCCGR-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|