C17H24O9 — CID 154706919
[(2R,3R,4R,5S,6R)-4,5,6-triacetyloxy-2-(2-methylprop-1-enyl)oxan-3-yl] acetate (PubChem CID 154706919) has the molecular formula C17H24O9 and a molecular weight of 372.37 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-4,5,6-triacetyloxy-2-(2-methylprop-1-enyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-4,5,6-triacetyloxy-2-(2-methylprop-1-enyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 154706919 |
| Molecular Formula | C17H24O9 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-4,5,6-triacetyloxy-2-(2-methylprop-1-enyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@H](C=C(C)C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H24O9/c1-8(2)7-13-14(22-9(3)18)15(23-10(4)19)16(24-11(5)20)17(26-13)25-12(6)21/h7,13-17H,1-6H3/t13-,14-,15-,16+,17+/m1/s1 |
| InChIKey | CJJUEDWUAPEOGO-MTSZKFMLSA-N |
| XLogP | 1.04 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|