C31H31N2O2+ — CID 154707050
2-[(1S,2S,4S,5R)-5-ethenyl-2-[(R)-hydroxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]-1-naphthalen-2-ylethanone (PubChem CID 154707050) has the molecular formula C31H31N2O2+ and a molecular weight of 463.60 g/mol. Its IUPAC name is 2-[(1S,2S,4S,5R)-5-ethenyl-2-[(R)-hydroxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]-1-naphthalen-2-ylethanone.
| Compound Name | 2-[(1S,2S,4S,5R)-5-ethenyl-2-[(R)-hydroxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]-1-naphthalen-2-ylethanone |
|---|---|
| PubChem CID | 154707050 |
| Molecular Formula | C31H31N2O2+ |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 2-[(1S,2S,4S,5R)-5-ethenyl-2-[(R)-hydroxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]-1-naphthalen-2-ylethanone |
| SMILES | C=C[C@H]1C[N@+]2(CC(=O)c3ccc4ccccc4c3)CC[C@H]1C[C@H]2[C@H](O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C31H31N2O2/c1-2-21-19-33(20-30(34)25-12-11-22-7-3-4-8-23(22)17-25)16-14-24(21)18-29(33)31(35)27-13-15-32-28-10-6-5-9-26(27)28/h2-13,15,17,21,24,29,31,35H,1,14,16,18-20H2/q+1/t21-,24-,29-,31+,33-/m0/s1 |
| InChIKey | RNADWBBTFWGVOW-UJLJLDBUSA-N |
| XLogP | 5.72 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|