C24H18N2O2 — CID 154707199
4-(2-methyl-4,6-diphenylphenyl)-3-nitropyridine (PubChem CID 154707199) has the molecular formula C24H18N2O2 and a molecular weight of 366.42 g/mol. Its IUPAC name is 4-(2-methyl-4,6-diphenylphenyl)-3-nitropyridine.
| Compound Name | 4-(2-methyl-4,6-diphenylphenyl)-3-nitropyridine |
|---|---|
| PubChem CID | 154707199 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 4-(2-methyl-4,6-diphenylphenyl)-3-nitropyridine |
| SMILES | Cc1cc(-c2ccccc2)cc(-c2ccccc2)c1-c1ccncc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H18N2O2/c1-17-14-20(18-8-4-2-5-9-18)15-22(19-10-6-3-7-11-19)24(17)21-12-13-25-16-23(21)26(27)28/h2-16H,1H3 |
| InChIKey | QIYRHYZPOGUFEK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|