About (2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran
(2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran (PubChem CID 154707243) has the molecular formula C16H16O2
and a molecular weight of 240.30 g/mol. Its IUPAC name is (2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | (2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran |
| PubChem CID | 154707243 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran |
| SMILES | COc1ccc([C@H]2Oc3ccccc3[C@@H]2C)cc1 |
| InChI | InChI=1S/C16H16O2/c1-11-14-5-3-4-6-15(14)18-16(11)12-7-9-13(17-2)10-8-12/h3-11,16H,1-2H3/t11-,16-/m0/s1 |
| InChIKey | FOULYACONOMCOW-ZBEGNZNMSA-N |
| XLogP | 3.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran?
The IUPAC name of (2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran (CID 154707243) is (2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran.
What is the SMILES notation for (2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran?
The canonical SMILES for (2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran is COc1ccc([C@H]2Oc3ccccc3[C@@H]2C)cc1.
What is the InChIKey of (2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran?
The InChIKey is FOULYACONOMCOW-ZBEGNZNMSA-N. The full InChI is InChI=1S/C16H16O2/c1-11-14-5-3-4-6-15(14)18-16(11)12-7-9-13(17-2)10-8-12/h3-11,16H,1-2H3/t11-,16-/m0/s1.
What are the key properties of (2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran?
(2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran has a molecular weight of 240.30 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-(4-methoxyphenyl)-3-methyl-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 154707243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).