C19H22O6 — CID 154707306
tert-butyl (3S)-3-hydroxy-4-(5-methoxy-1,4-dioxonaphthalen-2-yl)butanoate (PubChem CID 154707306) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is tert-butyl (3S)-3-hydroxy-4-(5-methoxy-1,4-dioxonaphthalen-2-yl)butanoate.
| Compound Name | tert-butyl (3S)-3-hydroxy-4-(5-methoxy-1,4-dioxonaphthalen-2-yl)butanoate |
|---|---|
| PubChem CID | 154707306 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | tert-butyl (3S)-3-hydroxy-4-(5-methoxy-1,4-dioxonaphthalen-2-yl)butanoate |
| SMILES | COc1cccc2c1C(=O)C=C(C[C@H](O)CC(=O)OC(C)(C)C)C2=O |
| InChI | InChI=1S/C19H22O6/c1-19(2,3)25-16(22)10-12(20)8-11-9-14(21)17-13(18(11)23)6-5-7-15(17)24-4/h5-7,9,12,20H,8,10H2,1-4H3/t12-/m0/s1 |
| InChIKey | DXZLVHRKDAUIET-LBPRGKRZSA-N |
| XLogP | 2.48 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|