C26H46O6Si — CID 154707325
methyl (1R,2S,3S)-2-hydroxy-2-(3-methoxycarbonylbut-3-enyl)-1-prop-2-enyl-3-[tri(propan-2-yl)silyloxymethyl]cyclopentane-1-carboxylate (PubChem CID 154707325) has the molecular formula C26H46O6Si and a molecular weight of 482.73 g/mol. Its IUPAC name is methyl (1R,2S,3S)-2-hydroxy-2-(3-methoxycarbonylbut-3-enyl)-1-prop-2-enyl-3-[tri(propan-2-yl)silyloxymethyl]cyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2S,3S)-2-hydroxy-2-(3-methoxycarbonylbut-3-enyl)-1-prop-2-enyl-3-[tri(propan-2-yl)silyloxymethyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 154707325 |
| Molecular Formula | C26H46O6Si |
| Molecular Weight | 482.73 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | methyl (1R,2S,3S)-2-hydroxy-2-(3-methoxycarbonylbut-3-enyl)-1-prop-2-enyl-3-[tri(propan-2-yl)silyloxymethyl]cyclopentane-1-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OC)CC[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@@]1(O)CCC(=C)C(=O)OC |
| InChI | InChI=1S/C26H46O6Si/c1-11-14-25(24(28)31-10)15-13-22(26(25,29)16-12-21(8)23(27)30-9)17-32-33(18(2)3,19(4)5)20(6)7/h11,18-20,22,29H,1,8,12-17H2,2-7,9-10H3/t22-,25+,26-/m0/s1 |
| InChIKey | VIPAMCQTRZUQJI-DFCKQENNSA-N |
| XLogP | 5.56 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.73 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|