C21H39IO5Si — CID 154707327
methyl (3aR,6S,6aS)-2-(hydroxymethyl)-6a-(iodomethyl)-6-[tri(propan-2-yl)silyloxymethyl]-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a-carboxylate (PubChem CID 154707327) has the molecular formula C21H39IO5Si and a molecular weight of 526.53 g/mol. Its IUPAC name is methyl (3aR,6S,6aS)-2-(hydroxymethyl)-6a-(iodomethyl)-6-[tri(propan-2-yl)silyloxymethyl]-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a-carboxylate.
| Compound Name | methyl (3aR,6S,6aS)-2-(hydroxymethyl)-6a-(iodomethyl)-6-[tri(propan-2-yl)silyloxymethyl]-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a-carboxylate |
|---|---|
| PubChem CID | 154707327 |
| Molecular Formula | C21H39IO5Si |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | methyl (3aR,6S,6aS)-2-(hydroxymethyl)-6a-(iodomethyl)-6-[tri(propan-2-yl)silyloxymethyl]-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a-carboxylate |
| SMILES | COC(=O)[C@@]12CC[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@]1(CI)OC(CO)C2 |
| InChI | InChI=1S/C21H39IO5Si/c1-14(2)28(15(3)4,16(5)6)26-12-17-8-9-20(19(24)25-7)10-18(11-23)27-21(17,20)13-22/h14-18,23H,8-13H2,1-7H3/t17-,18?,20-,21-/m0/s1 |
| InChIKey | WFKVDIWYNWETKI-DVMLBRBMSA-N |
| XLogP | 4.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|