C21H38O3Si — CID 154707336
trans-methyl (1R,3R)-2-methylidene-1-prop-2-enyl-3-[tri(propan-2-yl)silyloxymethyl]cyclopentane-1-carboxylate (PubChem CID 154707336) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is trans-methyl (1R,3R)-2-methylidene-1-prop-2-enyl-3-[tri(propan-2-yl)silyloxymethyl]cyclopentane-1-carboxylate.
| Compound Name | trans-methyl (1R,3R)-2-methylidene-1-prop-2-enyl-3-[tri(propan-2-yl)silyloxymethyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 154707336 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | trans-methyl (1R,3R)-2-methylidene-1-prop-2-enyl-3-[tri(propan-2-yl)silyloxymethyl]cyclopentane-1-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OC)CC[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)C1=C |
| InChI | InChI=1S/C21H38O3Si/c1-10-12-21(20(22)23-9)13-11-19(18(21)8)14-24-25(15(2)3,16(4)5)17(6)7/h10,15-17,19H,1,8,11-14H2,2-7,9H3/t19-,21-/m0/s1 |
| InChIKey | DUQKIDSZBKWXTJ-FPOVZHCZSA-N |
| XLogP | 5.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|