C21H40O5Si — CID 154707337
trans-methyl (1R,3R)-1-(2,3-dihydroxypropyl)-2-methylidene-3-[tri(propan-2-yl)silyloxymethyl]cyclopentane-1-carboxylate (PubChem CID 154707337) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is trans-methyl (1R,3R)-1-(2,3-dihydroxypropyl)-2-methylidene-3-[tri(propan-2-yl)silyloxymethyl]cyclopentane-1-carboxylate.
| Compound Name | trans-methyl (1R,3R)-1-(2,3-dihydroxypropyl)-2-methylidene-3-[tri(propan-2-yl)silyloxymethyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 154707337 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | trans-methyl (1R,3R)-1-(2,3-dihydroxypropyl)-2-methylidene-3-[tri(propan-2-yl)silyloxymethyl]cyclopentane-1-carboxylate |
| SMILES | C=C1[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)CC[C@]1(CC(O)CO)C(=O)OC |
| InChI | InChI=1S/C21H40O5Si/c1-14(2)27(15(3)4,16(5)6)26-13-18-9-10-21(17(18)7,20(24)25-8)11-19(23)12-22/h14-16,18-19,22-23H,7,9-13H2,1-6,8H3/t18-,19?,21+/m0/s1 |
| InChIKey | GLZRXKRFRZNCGN-OWJBEEKMSA-N |
| XLogP | 4.05 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|