About (2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one
(2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one (PubChem CID 154707556) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is (2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one.
Molecular Properties
| Compound Name | (2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one |
| PubChem CID | 154707556 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one |
| SMILES | COC(/C=C1\CCCC1=O)OC |
| InChI | InChI=1S/C9H14O3/c1-11-9(12-2)6-7-4-3-5-8(7)10/h6,9H,3-5H2,1-2H3/b7-6+ |
| InChIKey | NENDYDYJCMQZJI-VOTSOKGWSA-N |
| XLogP | 1.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one?
The IUPAC name of (2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one (CID 154707556) is (2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one.
What is the SMILES notation for (2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one?
The canonical SMILES for (2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one is COC(/C=C1\CCCC1=O)OC.
What is the InChIKey of (2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one?
The InChIKey is NENDYDYJCMQZJI-VOTSOKGWSA-N. The full InChI is InChI=1S/C9H14O3/c1-11-9(12-2)6-7-4-3-5-8(7)10/h6,9H,3-5H2,1-2H3/b7-6+.
What are the key properties of (2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one?
(2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one has a molecular weight of 170.21 g/mol, XLogP of 1.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(2,2-dimethoxyethylidene)cyclopentan-1-one is sourced from PubChem (CID 154707556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).