About (5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione
(5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione (PubChem CID 154707611) has the molecular formula C20H27NO2
and a molecular weight of 313.44 g/mol. Its IUPAC name is (5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione.
Molecular Properties
| Compound Name | (5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione |
| PubChem CID | 154707611 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione |
| SMILES | CC(C)(C)[C@@H]1CCC(=O)[C@@]2(CC1)CCN(c1ccccc1)C2=O |
| InChI | InChI=1S/C20H27NO2/c1-19(2,3)15-9-10-17(22)20(12-11-15)13-14-21(18(20)23)16-7-5-4-6-8-16/h4-8,15H,9-14H2,1-3H3/t15-,20-/m1/s1 |
| InChIKey | HHIYJIZEBQAMJH-FOIQADDNSA-N |
| XLogP | 4.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione?
The IUPAC name of (5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione (CID 154707611) is (5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione.
What is the SMILES notation for (5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione?
The canonical SMILES for (5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione is CC(C)(C)[C@@H]1CCC(=O)[C@@]2(CC1)CCN(c1ccccc1)C2=O.
What is the InChIKey of (5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione?
The InChIKey is HHIYJIZEBQAMJH-FOIQADDNSA-N. The full InChI is InChI=1S/C20H27NO2/c1-19(2,3)15-9-10-17(22)20(12-11-15)13-14-21(18(20)23)16-7-5-4-6-8-16/h4-8,15H,9-14H2,1-3H3/t15-,20-/m1/s1.
What are the key properties of (5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione?
(5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione has a molecular weight of 313.44 g/mol, XLogP of 4.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,9S)-9-tert-butyl-2-phenyl-2-azaspiro[4.6]undecane-1,6-dione is sourced from PubChem (CID 154707611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).