C33H28F5N3O2 — CID 154707639
N-[4-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-phenylmethoxymethyl]quinolin-6-yl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 154707639) has the molecular formula C33H28F5N3O2 and a molecular weight of 593.60 g/mol. Its IUPAC name is N-[4-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-phenylmethoxymethyl]quinolin-6-yl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[4-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-phenylmethoxymethyl]quinolin-6-yl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 154707639 |
| Molecular Formula | C33H28F5N3O2 |
| Molecular Weight | 593.60 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | N-[4-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-phenylmethoxymethyl]quinolin-6-yl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | C=CC1CN2CCC1CC2[C@H](OCc1ccccc1)c1ccnc2ccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)cc12 |
| InChI | InChI=1S/C33H28F5N3O2/c1-2-19-16-41-13-11-20(19)14-25(41)32(43-17-18-6-4-3-5-7-18)22-10-12-39-24-9-8-21(15-23(22)24)40-33(42)26-27(34)29(36)31(38)30(37)28(26)35/h2-10,12,15,19-20,25,32H,1,11,13-14,16-17H2,(H,40,42)/t19?,20?,25?,32-/m1/s1 |
| InChIKey | PJSFRQJVQQSQQG-PHLRNYLUSA-N |
| XLogP | 7.34 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.60 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|