C18H17NO2 — CID 154707735
(4aR,5R)-5-phenyl-4,4a,5,10-tetrahydro-3H-[1,3]oxazino[3,4-b]isoquinolin-1-one (PubChem CID 154707735) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is (4aR,5R)-5-phenyl-4,4a,5,10-tetrahydro-3H-[1,3]oxazino[3,4-b]isoquinolin-1-one.
| Compound Name | (4aR,5R)-5-phenyl-4,4a,5,10-tetrahydro-3H-[1,3]oxazino[3,4-b]isoquinolin-1-one |
|---|---|
| PubChem CID | 154707735 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (4aR,5R)-5-phenyl-4,4a,5,10-tetrahydro-3H-[1,3]oxazino[3,4-b]isoquinolin-1-one |
| SMILES | O=C1OCC[C@@H]2[C@H](c3ccccc3)c3ccccc3CN12 |
| InChI | InChI=1S/C18H17NO2/c20-18-19-12-14-8-4-5-9-15(14)17(16(19)10-11-21-18)13-6-2-1-3-7-13/h1-9,16-17H,10-12H2/t16-,17-/m1/s1 |
| InChIKey | CRQJNBFIJNRZFI-IAGOWNOFSA-N |
| XLogP | 3.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |