C36H29ClO4 — CID 154707848
(3aS,6aS)-5-[2-(3-chlorophenyl)ethynyl]-2,2-dimethyl-3a-(trityloxymethyl)-6aH-cyclopenta[d][1,3]dioxol-4-one (PubChem CID 154707848) has the molecular formula C36H29ClO4 and a molecular weight of 561.08 g/mol. Its IUPAC name is (3aS,6aS)-5-[2-(3-chlorophenyl)ethynyl]-2,2-dimethyl-3a-(trityloxymethyl)-6aH-cyclopenta[d][1,3]dioxol-4-one.
| Compound Name | (3aS,6aS)-5-[2-(3-chlorophenyl)ethynyl]-2,2-dimethyl-3a-(trityloxymethyl)-6aH-cyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 154707848 |
| Molecular Formula | C36H29ClO4 |
| Molecular Weight | 561.08 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | (3aS,6aS)-5-[2-(3-chlorophenyl)ethynyl]-2,2-dimethyl-3a-(trityloxymethyl)-6aH-cyclopenta[d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@H]2C=C(C#Cc3cccc(Cl)c3)C(=O)[C@@]2(COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C36H29ClO4/c1-34(2)40-32-24-27(22-21-26-13-12-20-31(37)23-26)33(38)35(32,41-34)25-39-36(28-14-6-3-7-15-28,29-16-8-4-9-17-29)30-18-10-5-11-19-30/h3-20,23-24,32H,25H2,1-2H3/t32-,35-/m0/s1 |
| InChIKey | ZDBKAUQMZVSVTR-SHUZPENHSA-N |
| XLogP | 7.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.08 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|