About 2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium
2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium (PubChem CID 154708184) has the molecular formula C12H23NO3Y-2
and a molecular weight of 318.23 g/mol. Its IUPAC name is 2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium.
Molecular Properties
| Compound Name | 2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium |
| PubChem CID | 154708184 |
| Molecular Formula | C12H23NO3Y-2 |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium |
| SMILES | CN([C-]=O)CC(C)(C)C(=O)O.[CH2-]CC(C)C.[Y] |
| InChI | InChI=1S/C7H12NO3.C5H11.Y/c1-7(2,6(10)11)4-8(3)5-9;1-4-5(2)3;/h4H2,1-3H3,(H,10,11);5H,1,4H2,2-3H3;/q2*-1; |
| InChIKey | RVMZRAPKXPKJRB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium?
The IUPAC name of 2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium (CID 154708184) is 2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium.
What is the SMILES notation for 2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium?
The canonical SMILES for 2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium is CN([C-]=O)CC(C)(C)C(=O)O.[CH2-]CC(C)C.[Y].
What is the InChIKey of 2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium?
The InChIKey is RVMZRAPKXPKJRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12NO3.C5H11.Y/c1-7(2,6(10)11)4-8(3)5-9;1-4-5(2)3;/h4H2,1-3H3,(H,10,11);5H,1,4H2,2-3H3;/q2*-1;.
What are the key properties of 2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium?
2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium has a molecular weight of 318.23 g/mol, XLogP of 1.96, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-[methyl(oxomethyl)amino]propanoic acid;2-methylbutane;yttrium is sourced from PubChem (CID 154708184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).