C18H26O11 — CID 154708330
[(2R,3R,4S,5R,6R)-2,3,4,5-tetraacetyloxy-6-hydroxyoct-7-enyl] acetate (PubChem CID 154708330) has the molecular formula C18H26O11 and a molecular weight of 418.40 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-2,3,4,5-tetraacetyloxy-6-hydroxyoct-7-enyl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-2,3,4,5-tetraacetyloxy-6-hydroxyoct-7-enyl] acetate |
|---|---|
| PubChem CID | 154708330 |
| Molecular Formula | C18H26O11 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-2,3,4,5-tetraacetyloxy-6-hydroxyoct-7-enyl] acetate |
| SMILES | C=C[C@@H](O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C18H26O11/c1-7-14(24)16(27-11(4)21)18(29-13(6)23)17(28-12(5)22)15(26-10(3)20)8-25-9(2)19/h7,14-18,24H,1,8H2,2-6H3/t14-,15-,16-,17-,18+/m1/s1 |
| InChIKey | VSYSABKTGIWYQN-ZKXLYKBJSA-N |
| XLogP | -0.18 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|