C14H20O6 — CID 154708342
[(E,2R,3S,6R)-2,6-dihydroxy-6-[(2S)-5-oxooxolan-2-yl]hex-4-en-3-yl] (E)-but-2-enoate (PubChem CID 154708342) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is [(E,2R,3S,6R)-2,6-dihydroxy-6-[(2S)-5-oxooxolan-2-yl]hex-4-en-3-yl] (E)-but-2-enoate.
| Compound Name | [(E,2R,3S,6R)-2,6-dihydroxy-6-[(2S)-5-oxooxolan-2-yl]hex-4-en-3-yl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 154708342 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | [(E,2R,3S,6R)-2,6-dihydroxy-6-[(2S)-5-oxooxolan-2-yl]hex-4-en-3-yl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O[C@@H](/C=C/[C@@H](O)[C@@H]1CCC(=O)O1)[C@@H](C)O |
| InChI | InChI=1S/C14H20O6/c1-3-4-13(17)19-11(9(2)15)6-5-10(16)12-7-8-14(18)20-12/h3-6,9-12,15-16H,7-8H2,1-2H3/b4-3+,6-5+/t9-,10-,11+,12+/m1/s1 |
| InChIKey | USKWIFWDYAQQML-FPZOSCAUSA-N |
| XLogP | 0.48 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|