C13H14F6O3S — CID 154708372
[5,5,5-trifluoro-3-(trifluoromethyl)pentyl] 4-methylbenzenesulfonate (PubChem CID 154708372) has the molecular formula C13H14F6O3S and a molecular weight of 364.31 g/mol. Its IUPAC name is [5,5,5-trifluoro-3-(trifluoromethyl)pentyl] 4-methylbenzenesulfonate.
| Compound Name | [5,5,5-trifluoro-3-(trifluoromethyl)pentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 154708372 |
| Molecular Formula | C13H14F6O3S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | [5,5,5-trifluoro-3-(trifluoromethyl)pentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC(CC(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F6O3S/c1-9-2-4-11(5-3-9)23(20,21)22-7-6-10(13(17,18)19)8-12(14,15)16/h2-5,10H,6-8H2,1H3 |
| InChIKey | MBHMXLZMRKUFSE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|