About N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine
N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine (PubChem CID 154708387) has the molecular formula C8H19IN2O2S
and a molecular weight of 334.22 g/mol. Its IUPAC name is N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine |
| PubChem CID | 154708387 |
| Molecular Formula | C8H19IN2O2S |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine |
| SMILES | CC(C)CC(C)N(C)S(=O)(=O)N(C)I |
| InChI | InChI=1S/C8H19IN2O2S/c1-7(2)6-8(3)10(4)14(12,13)11(5)9/h7-8H,6H2,1-5H3 |
| InChIKey | YGFNDUQNVYPUGU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine?
The IUPAC name of N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine (CID 154708387) is N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine.
What is the SMILES notation for N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine?
The canonical SMILES for N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine is CC(C)CC(C)N(C)S(=O)(=O)N(C)I.
What is the InChIKey of N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine?
The InChIKey is YGFNDUQNVYPUGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19IN2O2S/c1-7(2)6-8(3)10(4)14(12,13)11(5)9/h7-8H,6H2,1-5H3.
What are the key properties of N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine?
N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine has a molecular weight of 334.22 g/mol, XLogP of 1.88, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[iodo(methyl)sulfamoyl]-N,4-dimethylpentan-2-amine is sourced from PubChem (CID 154708387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).