C13H17F3P+ — CID 154708449
1-(2,2,2-trifluoroethyl)-1-(2,4,6-trimethylphenyl)phosphiran-1-ium (PubChem CID 154708449) has the molecular formula C13H17F3P+ and a molecular weight of 261.25 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-1-(2,4,6-trimethylphenyl)phosphiran-1-ium.
| Compound Name | 1-(2,2,2-trifluoroethyl)-1-(2,4,6-trimethylphenyl)phosphiran-1-ium |
|---|---|
| PubChem CID | 154708449 |
| Molecular Formula | C13H17F3P+ |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-1-(2,4,6-trimethylphenyl)phosphiran-1-ium |
| SMILES | Cc1cc(C)c([P+]2(CC(F)(F)F)CC2)c(C)c1 |
| InChI | InChI=1S/C13H17F3P/c1-9-6-10(2)12(11(3)7-9)17(4-5-17)8-13(14,15)16/h6-7H,4-5,8H2,1-3H3/q+1 |
| InChIKey | DUDMDZWOOONDTK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|