C41H42N2O2 — CID 154708471
(4S)-2-[1,1,1',1',6,6'-hexamethyl-4'-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-3,3'-spirobi[2H-indene]-4-yl]-4-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 154708471) has the molecular formula C41H42N2O2 and a molecular weight of 594.80 g/mol. Its IUPAC name is (4S)-2-[1,1,1',1',6,6'-hexamethyl-4'-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-3,3'-spirobi[2H-indene]-4-yl]-4-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-[1,1,1',1',6,6'-hexamethyl-4'-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-3,3'-spirobi[2H-indene]-4-yl]-4-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 154708471 |
| Molecular Formula | C41H42N2O2 |
| Molecular Weight | 594.80 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | (4S)-2-[1,1,1',1',6,6'-hexamethyl-4'-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-3,3'-spirobi[2H-indene]-4-yl]-4-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1cc(C2=N[C@@H](c3ccccc3)CO2)c2c(c1)C(C)(C)CC21CC(C)(C)c2cc(C)cc(C3=N[C@@H](c4ccccc4)CO3)c21 |
| InChI | InChI=1S/C41H42N2O2/c1-25-17-29(37-42-33(21-44-37)27-13-9-7-10-14-27)35-31(19-25)39(3,4)23-41(35)24-40(5,6)32-20-26(2)18-30(36(32)41)38-43-34(22-45-38)28-15-11-8-12-16-28/h7-20,33-34H,21-24H2,1-6H3/t33-,34-,41?/m1/s1 |
| InChIKey | YBJRRZZGOSYYTJ-RTIOKJKTSA-N |
| XLogP | 8.99 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.80 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |