C25H28O4 — CID 154708474
5,5'-dihydroxy-1,1,1',1',6,6'-hexamethyl-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde (PubChem CID 154708474) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is 5,5'-dihydroxy-1,1,1',1',6,6'-hexamethyl-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde.
| Compound Name | 5,5'-dihydroxy-1,1,1',1',6,6'-hexamethyl-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde |
|---|---|
| PubChem CID | 154708474 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 5,5'-dihydroxy-1,1,1',1',6,6'-hexamethyl-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde |
| SMILES | Cc1cc2c(c(C=O)c1O)C1(CC2(C)C)CC(C)(C)c2cc(C)c(O)c(C=O)c21 |
| InChI | InChI=1S/C25H28O4/c1-13-7-17-19(15(9-26)21(13)28)25(11-23(17,3)4)12-24(5,6)18-8-14(2)22(29)16(10-27)20(18)25/h7-10,28-29H,11-12H2,1-6H3 |
| InChIKey | WXVKQJKUJKUUQI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|