C27H26F6O8S2 — CID 154708475
[4,4'-diformyl-1,1,1',1',6,6'-hexamethyl-5'-(trifluoromethylsulfonyloxy)-3,3'-spirobi[2H-indene]-5-yl] trifluoromethanesulfonate (PubChem CID 154708475) has the molecular formula C27H26F6O8S2 and a molecular weight of 656.62 g/mol. Its IUPAC name is [4,4'-diformyl-1,1,1',1',6,6'-hexamethyl-5'-(trifluoromethylsulfonyloxy)-3,3'-spirobi[2H-indene]-5-yl] trifluoromethanesulfonate.
| Compound Name | [4,4'-diformyl-1,1,1',1',6,6'-hexamethyl-5'-(trifluoromethylsulfonyloxy)-3,3'-spirobi[2H-indene]-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 154708475 |
| Molecular Formula | C27H26F6O8S2 |
| Molecular Weight | 656.62 g/mol |
| Exact Mass | 656.10 |
| IUPAC Name | [4,4'-diformyl-1,1,1',1',6,6'-hexamethyl-5'-(trifluoromethylsulfonyloxy)-3,3'-spirobi[2H-indene]-5-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc2c(c(C=O)c1OS(=O)(=O)C(F)(F)F)C1(CC2(C)C)CC(C)(C)c2cc(C)c(OS(=O)(=O)C(F)(F)F)c(C=O)c21 |
| InChI | InChI=1S/C27H26F6O8S2/c1-13-7-17-19(15(9-34)21(13)40-42(36,37)26(28,29)30)25(11-23(17,3)4)12-24(5,6)18-8-14(2)22(16(10-35)20(18)25)41-43(38,39)27(31,32)33/h7-10H,11-12H2,1-6H3 |
| InChIKey | RUPYPQBCTPFXEO-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.62 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|