About 2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone
2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone (PubChem CID 154708517) has the molecular formula C12H11Cl2N3O
and a molecular weight of 284.15 g/mol. Its IUPAC name is 2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone.
Molecular Properties
| Compound Name | 2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone |
| PubChem CID | 154708517 |
| Molecular Formula | C12H11Cl2N3O |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone |
| SMILES | [N-]=[N+]=C(C(=O)N1CCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N3O/c13-9-4-3-8(7-10(9)14)11(16-15)12(18)17-5-1-2-6-17/h3-4,7H,1-2,5-6H2 |
| InChIKey | GFIFVUBQIDEOPJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone?
The IUPAC name of 2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone (CID 154708517) is 2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone.
What is the SMILES notation for 2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone?
The canonical SMILES for 2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone is [N-]=[N+]=C(C(=O)N1CCCC1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone?
The InChIKey is GFIFVUBQIDEOPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2N3O/c13-9-4-3-8(7-10(9)14)11(16-15)12(18)17-5-1-2-6-17/h3-4,7H,1-2,5-6H2.
What are the key properties of 2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone?
2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone has a molecular weight of 284.15 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazo-2-(3,4-dichlorophenyl)-1-pyrrolidin-1-ylethanone is sourced from PubChem (CID 154708517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).