About N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline
N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline (PubChem CID 154708781) has the molecular formula C14H19Cl2F2N
and a molecular weight of 310.22 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline.
Molecular Properties
| Compound Name | N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline |
| PubChem CID | 154708781 |
| Molecular Formula | C14H19Cl2F2N |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline |
| SMILES | FC(F)CCCc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C14H19Cl2F2N/c15-8-10-19(11-9-16)13-6-4-12(5-7-13)2-1-3-14(17)18/h4-7,14H,1-3,8-11H2 |
| InChIKey | GPSTZMKSMKPOSG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline?
The IUPAC name of N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline (CID 154708781) is N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline.
What is the SMILES notation for N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline?
The canonical SMILES for N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline is FC(F)CCCc1ccc(N(CCCl)CCCl)cc1.
What is the InChIKey of N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline?
The InChIKey is GPSTZMKSMKPOSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19Cl2F2N/c15-8-10-19(11-9-16)13-6-4-12(5-7-13)2-1-3-14(17)18/h4-7,14H,1-3,8-11H2.
What are the key properties of N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline?
N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline has a molecular weight of 310.22 g/mol, XLogP of 4.56, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-chloroethyl)-4-(4,4-difluorobutyl)aniline is sourced from PubChem (CID 154708781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).