C21H34BNO4 — CID 154708854
tert-butyl N-methyl-N-[(2S)-2-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]carbamate (PubChem CID 154708854) has the molecular formula C21H34BNO4 and a molecular weight of 375.32 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[(2S)-2-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[(2S)-2-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 154708854 |
| Molecular Formula | C21H34BNO4 |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | tert-butyl N-methyl-N-[(2S)-2-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]carbamate |
| SMILES | CN(C[C@@H](CB1OC(C)(C)C(C)(C)O1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H34BNO4/c1-19(2,3)25-18(24)23(8)15-17(16-12-10-9-11-13-16)14-22-26-20(4,5)21(6,7)27-22/h9-13,17H,14-15H2,1-8H3/t17-/m1/s1 |
| InChIKey | GZHVRHZNYNEBDA-QGZVFWFLSA-N |
| XLogP | 4.73 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|