C38H32O4 — CID 154708897
(3aS,6aS)-2,2-dimethyl-5-naphthalen-1-yl-3a-(trityloxymethyl)-6aH-cyclopenta[d][1,3]dioxol-4-one (PubChem CID 154708897) has the molecular formula C38H32O4 and a molecular weight of 552.67 g/mol. Its IUPAC name is (3aS,6aS)-2,2-dimethyl-5-naphthalen-1-yl-3a-(trityloxymethyl)-6aH-cyclopenta[d][1,3]dioxol-4-one.
| Compound Name | (3aS,6aS)-2,2-dimethyl-5-naphthalen-1-yl-3a-(trityloxymethyl)-6aH-cyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 154708897 |
| Molecular Formula | C38H32O4 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | (3aS,6aS)-2,2-dimethyl-5-naphthalen-1-yl-3a-(trityloxymethyl)-6aH-cyclopenta[d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@H]2C=C(c3cccc4ccccc34)C(=O)[C@@]2(COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C38H32O4/c1-36(2)41-34-25-33(32-24-14-16-27-15-12-13-23-31(27)32)35(39)37(34,42-36)26-40-38(28-17-6-3-7-18-28,29-19-8-4-9-20-29)30-21-10-5-11-22-30/h3-25,34H,26H2,1-2H3/t34-,37-/m0/s1 |
| InChIKey | UZBINWBWCGMJJX-UNVMMQEESA-N |
| XLogP | 7.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|