C10H7FN2O3 — CID 154708968
3-(4-fluorophenyl)-5-methyl-4-nitro-1,2-oxazole (PubChem CID 154708968) has the molecular formula C10H7FN2O3 and a molecular weight of 222.18 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-methyl-4-nitro-1,2-oxazole.
| Compound Name | 3-(4-fluorophenyl)-5-methyl-4-nitro-1,2-oxazole |
|---|---|
| PubChem CID | 154708968 |
| Molecular Formula | C10H7FN2O3 |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 3-(4-fluorophenyl)-5-methyl-4-nitro-1,2-oxazole |
| SMILES | Cc1onc(-c2ccc(F)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7FN2O3/c1-6-10(13(14)15)9(12-16-6)7-2-4-8(11)5-3-7/h2-5H,1H3 |
| InChIKey | TWBUFFRMHZOZFR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|