C25H36F2O5 — CID 154708985
[(2S)-2-(4-tert-butylbenzoyl)-5-ethoxy-4,4-difluoro-5-oxopentyl] heptanoate (PubChem CID 154708985) has the molecular formula C25H36F2O5 and a molecular weight of 454.55 g/mol. Its IUPAC name is [(2S)-2-(4-tert-butylbenzoyl)-5-ethoxy-4,4-difluoro-5-oxopentyl] heptanoate.
| Compound Name | [(2S)-2-(4-tert-butylbenzoyl)-5-ethoxy-4,4-difluoro-5-oxopentyl] heptanoate |
|---|---|
| PubChem CID | 154708985 |
| Molecular Formula | C25H36F2O5 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | [(2S)-2-(4-tert-butylbenzoyl)-5-ethoxy-4,4-difluoro-5-oxopentyl] heptanoate |
| SMILES | CCCCCCC(=O)OC[C@H](CC(F)(F)C(=O)OCC)C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H36F2O5/c1-6-8-9-10-11-21(28)32-17-19(16-25(26,27)23(30)31-7-2)22(29)18-12-14-20(15-13-18)24(3,4)5/h12-15,19H,6-11,16-17H2,1-5H3/t19-/m0/s1 |
| InChIKey | ZFGXZWNPSQQIMX-IBGZPJMESA-N |
| XLogP | 5.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|