C33H33BFNO2 — CID 154709129
3-[(1R)-1-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-9-phenylcarbazole (PubChem CID 154709129) has the molecular formula C33H33BFNO2 and a molecular weight of 505.44 g/mol. Its IUPAC name is 3-[(1R)-1-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-9-phenylcarbazole.
| Compound Name | 3-[(1R)-1-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 154709129 |
| Molecular Formula | C33H33BFNO2 |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 3-[(1R)-1-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-9-phenylcarbazole |
| SMILES | CC1(C)OB(CC[C@H](c2ccc(F)cc2)c2ccc3c(c2)c2ccccc2n3-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C33H33BFNO2/c1-32(2)33(3,4)38-34(37-32)21-20-27(23-14-17-25(35)18-15-23)24-16-19-31-29(22-24)28-12-8-9-13-30(28)36(31)26-10-6-5-7-11-26/h5-19,22,27H,20-21H2,1-4H3/t27-/m1/s1 |
| InChIKey | MRWYCSBWAQBYQF-HHHXNRCGSA-N |
| XLogP | 8.54 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|