C16H21F3O2 — CID 154709132
[(2S)-4,4-dimethyl-2-[3-(trifluoromethyl)phenyl]pentyl] acetate (PubChem CID 154709132) has the molecular formula C16H21F3O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is [(2S)-4,4-dimethyl-2-[3-(trifluoromethyl)phenyl]pentyl] acetate.
| Compound Name | [(2S)-4,4-dimethyl-2-[3-(trifluoromethyl)phenyl]pentyl] acetate |
|---|---|
| PubChem CID | 154709132 |
| Molecular Formula | C16H21F3O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(2S)-4,4-dimethyl-2-[3-(trifluoromethyl)phenyl]pentyl] acetate |
| SMILES | CC(=O)OC[C@@H](CC(C)(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3O2/c1-11(20)21-10-13(9-15(2,3)4)12-6-5-7-14(8-12)16(17,18)19/h5-8,13H,9-10H2,1-4H3/t13-/m1/s1 |
| InChIKey | VORQSCPYIGHBOW-CYBMUJFWSA-N |
| XLogP | 4.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |