About 4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile
4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile (PubChem CID 154709177) has the molecular formula C14H12N2O3
and a molecular weight of 256.26 g/mol. Its IUPAC name is 4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile |
| PubChem CID | 154709177 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C/CON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C14H12N2O3/c15-10-12-5-3-11(4-6-12)2-1-9-19-16-13(17)7-8-14(16)18/h1-6H,7-9H2/b2-1+ |
| InChIKey | XUBGNGBTKYNYQS-OWOJBTEDSA-N |
| XLogP | 1.65 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile?
The IUPAC name of 4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile (CID 154709177) is 4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile.
What is the SMILES notation for 4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile?
The canonical SMILES for 4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile is N#Cc1ccc(/C=C/CON2C(=O)CCC2=O)cc1.
What is the InChIKey of 4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile?
The InChIKey is XUBGNGBTKYNYQS-OWOJBTEDSA-N. The full InChI is InChI=1S/C14H12N2O3/c15-10-12-5-3-11(4-6-12)2-1-9-19-16-13(17)7-8-14(16)18/h1-6H,7-9H2/b2-1+.
What are the key properties of 4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile?
4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile has a molecular weight of 256.26 g/mol, XLogP of 1.65, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-3-(2,5-dioxopyrrolidin-1-yl)oxyprop-1-enyl]benzonitrile is sourced from PubChem (CID 154709177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).