C22H44O5Si2 — CID 154709337
(5S)-5-[(E,1R,4S,5R)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxyhex-2-enyl]oxolan-2-one (PubChem CID 154709337) has the molecular formula C22H44O5Si2 and a molecular weight of 444.76 g/mol. Its IUPAC name is (5S)-5-[(E,1R,4S,5R)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxyhex-2-enyl]oxolan-2-one.
| Compound Name | (5S)-5-[(E,1R,4S,5R)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxyhex-2-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 154709337 |
| Molecular Formula | C22H44O5Si2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | (5S)-5-[(E,1R,4S,5R)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxyhex-2-enyl]oxolan-2-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C22H44O5Si2/c1-16(26-28(8,9)21(2,3)4)17(23)12-13-19(18-14-15-20(24)25-18)27-29(10,11)22(5,6)7/h12-13,16-19,23H,14-15H2,1-11H3/b13-12+/t16-,17+,18+,19-/m1/s1 |
| InChIKey | LESZSKMDZZUHEX-PLWSTXDRSA-N |
| XLogP | 5.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|