C11H8BrF2O3Y- — CID 154709340
methyl 2-(5-bromo-3,3-difluoro-1-benzofuran-2-id-2-yl)acetate;yttrium (PubChem CID 154709340) has the molecular formula C11H8BrF2O3Y- and a molecular weight of 394.99 g/mol. Its IUPAC name is methyl 2-(5-bromo-3,3-difluoro-1-benzofuran-2-id-2-yl)acetate;yttrium.
| Compound Name | methyl 2-(5-bromo-3,3-difluoro-1-benzofuran-2-id-2-yl)acetate;yttrium |
|---|---|
| PubChem CID | 154709340 |
| Molecular Formula | C11H8BrF2O3Y- |
| Molecular Weight | 394.99 g/mol |
| Exact Mass | 393.87 |
| IUPAC Name | methyl 2-(5-bromo-3,3-difluoro-1-benzofuran-2-id-2-yl)acetate;yttrium |
| SMILES | COC(=O)C[C-]1Oc2ccc(Br)cc2C1(F)F.[Y] |
| InChI | InChI=1S/C11H8BrF2O3.Y/c1-16-10(15)5-9-11(13,14)7-4-6(12)2-3-8(7)17-9;/h2-4H,5H2,1H3;/q-1; |
| InChIKey | CFLMJBOTBSSONZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.99 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|