C13H20 — CID 154709429
(5E,7E,9E)-5,9-dimethylundeca-1,5,7,9-tetraene (PubChem CID 154709429) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (5E,7E,9E)-5,9-dimethylundeca-1,5,7,9-tetraene.
| Compound Name | (5E,7E,9E)-5,9-dimethylundeca-1,5,7,9-tetraene |
|---|---|
| PubChem CID | 154709429 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (5E,7E,9E)-5,9-dimethylundeca-1,5,7,9-tetraene |
| SMILES | C=CCC/C(C)=C/C=C/C(C)=C/C |
| InChI | InChI=1S/C13H20/c1-5-7-9-13(4)11-8-10-12(3)6-2/h5-6,8,10-11H,1,7,9H2,2-4H3/b10-8+,12-6+,13-11+ |
| InChIKey | JZSIPFXPANGVMI-FNOJJWLISA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|