C23H40O8SSi — CID 154709459
[(1S,2S,3R,4E,6R,7R,8S,9R)-2-hydroxy-6-methoxy-4,11,11-trimethyl-13-oxo-7-triethylsilyloxy-12-oxatricyclo[6.3.2.01,9]tridec-4-en-3-yl] methanesulfonate (PubChem CID 154709459) has the molecular formula C23H40O8SSi and a molecular weight of 504.72 g/mol. Its IUPAC name is [(1S,2S,3R,4E,6R,7R,8S,9R)-2-hydroxy-6-methoxy-4,11,11-trimethyl-13-oxo-7-triethylsilyloxy-12-oxatricyclo[6.3.2.01,9]tridec-4-en-3-yl] methanesulfonate.
| Compound Name | [(1S,2S,3R,4E,6R,7R,8S,9R)-2-hydroxy-6-methoxy-4,11,11-trimethyl-13-oxo-7-triethylsilyloxy-12-oxatricyclo[6.3.2.01,9]tridec-4-en-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 154709459 |
| Molecular Formula | C23H40O8SSi |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | [(1S,2S,3R,4E,6R,7R,8S,9R)-2-hydroxy-6-methoxy-4,11,11-trimethyl-13-oxo-7-triethylsilyloxy-12-oxatricyclo[6.3.2.01,9]tridec-4-en-3-yl] methanesulfonate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H]2C(=O)O[C@]3([C@@H]2CC3(C)C)[C@@H](O)[C@H](OS(C)(=O)=O)/C(C)=C\[C@H]1OC |
| InChI | InChI=1S/C23H40O8SSi/c1-9-33(10-2,11-3)31-19-16(28-7)12-14(4)18(30-32(8,26)27)20(24)23-15(13-22(23,5)6)17(19)21(25)29-23/h12,15-20,24H,9-11,13H2,1-8H3/b14-12-/t15-,16-,17+,18-,19+,20+,23-/m1/s1 |
| InChIKey | YHOIZOMTOMDFRW-YVHCZDOOSA-N |
| XLogP | 3.02 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|