C18H9F — CID 154709573
2-fluoropentacyclo[10.6.0.03,10.04,9.013,18]octadeca-1(12),2,4,6,8,10,13,15,17-nonaene (PubChem CID 154709573) has the molecular formula C18H9F and a molecular weight of 244.27 g/mol. Its IUPAC name is 2-fluoropentacyclo[10.6.0.03,10.04,9.013,18]octadeca-1(12),2,4,6,8,10,13,15,17-nonaene.
| Compound Name | 2-fluoropentacyclo[10.6.0.03,10.04,9.013,18]octadeca-1(12),2,4,6,8,10,13,15,17-nonaene |
|---|---|
| PubChem CID | 154709573 |
| Molecular Formula | C18H9F |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-fluoropentacyclo[10.6.0.03,10.04,9.013,18]octadeca-1(12),2,4,6,8,10,13,15,17-nonaene |
| SMILES | Fc1c2c3ccccc3c2cc2c3ccccc3c12 |
| InChI | InChI=1S/C18H9F/c19-18-16-12-7-3-1-5-10(12)14(16)9-15-11-6-2-4-8-13(11)17(15)18/h1-9H |
| InChIKey | PMXGGXORKFGRTR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |