C25H39N5O6SSi2 — CID 154709645
[2-amino-9-[4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 154709645) has the molecular formula C25H39N5O6SSi2 and a molecular weight of 593.86 g/mol. Its IUPAC name is [2-amino-9-[4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [2-amino-9-[4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 154709645 |
| Molecular Formula | C25H39N5O6SSi2 |
| Molecular Weight | 593.86 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | [2-amino-9-[4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)Oc2nc(N)nc3c2ncn3C2CC(O[Si](C)(C)C)C(CO[Si](C)(C)C)O2)c(C)c1 |
| InChI | InChI=1S/C25H39N5O6SSi2/c1-15-10-16(2)22(17(3)11-15)37(31,32)35-24-21-23(28-25(26)29-24)30(14-27-21)20-12-18(36-39(7,8)9)19(34-20)13-33-38(4,5)6/h10-11,14,18-20H,12-13H2,1-9H3,(H2,26,28,29) |
| InChIKey | ZPQNOGNFJRMNEG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|