About 1-methyl-3H-thieno[2,3-d]imidazol-2-one
1-methyl-3H-thieno[2,3-d]imidazol-2-one (PubChem CID 15470967) has the molecular formula C6H6N2OS
and a molecular weight of 154.19 g/mol. Its IUPAC name is 1-methyl-3H-thieno[2,3-d]imidazol-2-one.
Molecular Properties
| Compound Name | 1-methyl-3H-thieno[2,3-d]imidazol-2-one |
| PubChem CID | 15470967 |
| Molecular Formula | C6H6N2OS |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | 1-methyl-3H-thieno[2,3-d]imidazol-2-one |
| SMILES | Cn1c(=O)[nH]c2sccc21 |
| InChI | InChI=1S/C6H6N2OS/c1-8-4-2-3-10-5(4)7-6(8)9/h2-3H,1H3,(H,7,9) |
| InChIKey | SKYSKNXOGXDPKV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3H-thieno[2,3-d]imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3H-thieno[2,3-d]imidazol-2-one?
The IUPAC name of 1-methyl-3H-thieno[2,3-d]imidazol-2-one (CID 15470967) is 1-methyl-3H-thieno[2,3-d]imidazol-2-one.
What is the SMILES notation for 1-methyl-3H-thieno[2,3-d]imidazol-2-one?
The canonical SMILES for 1-methyl-3H-thieno[2,3-d]imidazol-2-one is Cn1c(=O)[nH]c2sccc21.
What is the InChIKey of 1-methyl-3H-thieno[2,3-d]imidazol-2-one?
The InChIKey is SKYSKNXOGXDPKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2OS/c1-8-4-2-3-10-5(4)7-6(8)9/h2-3H,1H3,(H,7,9).
What are the key properties of 1-methyl-3H-thieno[2,3-d]imidazol-2-one?
1-methyl-3H-thieno[2,3-d]imidazol-2-one has a molecular weight of 154.19 g/mol, XLogP of 0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3H-thieno[2,3-d]imidazol-2-one is sourced from PubChem (CID 15470967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).