About [(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane
[(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 154709737) has the molecular formula C21H34O3Si
and a molecular weight of 362.59 g/mol. Its IUPAC name is [(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane |
| PubChem CID | 154709737 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | [(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C=C(/C=C/c1cc(OC)cc(OC)c1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H34O3Si/c1-15(2)25(16(3)4,17(5)6)24-18(7)10-11-19-12-20(22-8)14-21(13-19)23-9/h10-17H,7H2,1-6,8-9H3/b11-10+ |
| InChIKey | YMHYJPIGVFXVSA-ZHACJKMWSA-N |
| XLogP | 6.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane?
The IUPAC name of [(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane (CID 154709737) is [(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane.
What is the SMILES notation for [(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane?
The canonical SMILES for [(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane is C=C(/C=C/c1cc(OC)cc(OC)c1)O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of [(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane?
The InChIKey is YMHYJPIGVFXVSA-ZHACJKMWSA-N. The full InChI is InChI=1S/C21H34O3Si/c1-15(2)25(16(3)4,17(5)6)24-18(7)10-11-19-12-20(22-8)14-21(13-19)23-9/h10-17H,7H2,1-6,8-9H3/b11-10+.
What are the key properties of [(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane?
[(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane has a molecular weight of 362.59 g/mol, XLogP of 6.42, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-4-(3,5-dimethoxyphenyl)buta-1,3-dien-2-yl]oxy-tri(propan-2-yl)silane is sourced from PubChem (CID 154709737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).